C17H16FN3 — CID 43381660
1-(2,4-dimethylphenyl)-3-(2-fluorophenyl)pyrazol-5-amine (PubChem CID 43381660) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(2-fluorophenyl)pyrazol-5-amine.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(2-fluorophenyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 43381660 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(2-fluorophenyl)pyrazol-5-amine |
| SMILES | Cc1ccc(-n2nc(-c3ccccc3F)cc2N)c(C)c1 |
| InChI | InChI=1S/C17H16FN3/c1-11-7-8-16(12(2)9-11)21-17(19)10-15(20-21)13-5-3-4-6-14(13)18/h3-10H,19H2,1-2H3 |
| InChIKey | ACLPOULYPUZGLF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |