C15H20N2S — CID 43382066
4-ethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43382066) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 4-ethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43382066 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-ethyl-N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC1CSC(Nc2cccc3c2CCCC3)=N1 |
| InChI | InChI=1S/C15H20N2S/c1-2-12-10-18-15(16-12)17-14-9-5-7-11-6-3-4-8-13(11)14/h5,7,9,12H,2-4,6,8,10H2,1H3,(H,16,17) |
| InChIKey | ISHMLHOXGUQZTO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |