About 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine
5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 43383094) has the molecular formula C13H10FN3S
and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine |
| PubChem CID | 43383094 |
| Molecular Formula | C13H10FN3S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | Nc1c(Nc2ccccc2F)ccc2scnc12 |
| InChI | InChI=1S/C13H10FN3S/c14-8-3-1-2-4-9(8)17-10-5-6-11-13(12(10)15)16-7-18-11/h1-7,17H,15H2 |
| InChIKey | XKBOSJWOMDHOCT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine?
The IUPAC name of 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine (CID 43383094) is 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine.
What is the SMILES notation for 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine?
The canonical SMILES for 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine is Nc1c(Nc2ccccc2F)ccc2scnc12.
What is the InChIKey of 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine?
The InChIKey is XKBOSJWOMDHOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN3S/c14-8-3-1-2-4-9(8)17-10-5-6-11-13(12(10)15)16-7-18-11/h1-7,17H,15H2.
What are the key properties of 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine?
5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine has a molecular weight of 259.31 g/mol, XLogP of 3.76, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2-fluorophenyl)-1,3-benzothiazole-4,5-diamine is sourced from PubChem (CID 43383094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).