About 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine
5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine (PubChem CID 43383127) has the molecular formula C13H9FN2OS
and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine |
| PubChem CID | 43383127 |
| Molecular Formula | C13H9FN2OS |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine |
| SMILES | Nc1c(Oc2cccc(F)c2)ccc2scnc12 |
| InChI | InChI=1S/C13H9FN2OS/c14-8-2-1-3-9(6-8)17-10-4-5-11-13(12(10)15)16-7-18-11/h1-7H,15H2 |
| InChIKey | FCKJZXVTTBGXPA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine?
The IUPAC name of 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine (CID 43383127) is 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine.
What is the SMILES notation for 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine?
The canonical SMILES for 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine is Nc1c(Oc2cccc(F)c2)ccc2scnc12.
What is the InChIKey of 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine?
The InChIKey is FCKJZXVTTBGXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9FN2OS/c14-8-2-1-3-9(6-8)17-10-4-5-11-13(12(10)15)16-7-18-11/h1-7H,15H2.
What are the key properties of 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine?
5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine has a molecular weight of 260.29 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-fluorophenoxy)-1,3-benzothiazol-4-amine is sourced from PubChem (CID 43383127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).