C10H8F4N2OS — CID 43383136
5-(2,2,3,3-tetrafluoropropoxy)-1,3-benzothiazol-4-amine (PubChem CID 43383136) has the molecular formula C10H8F4N2OS and a molecular weight of 280.25 g/mol. Its IUPAC name is 5-(2,2,3,3-tetrafluoropropoxy)-1,3-benzothiazol-4-amine.
| Compound Name | 5-(2,2,3,3-tetrafluoropropoxy)-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 43383136 |
| Molecular Formula | C10H8F4N2OS |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-(2,2,3,3-tetrafluoropropoxy)-1,3-benzothiazol-4-amine |
| SMILES | Nc1c(OCC(F)(F)C(F)F)ccc2scnc12 |
| InChI | InChI=1S/C10H8F4N2OS/c11-9(12)10(13,14)3-17-5-1-2-6-8(7(5)15)16-4-18-6/h1-2,4,9H,3,15H2 |
| InChIKey | GXZVZNHWUTXWMA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|