C13H15N3O2 — CID 43383719
N-[(3-aminophenyl)methyl]-N,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 43383719) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-N,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(3-aminophenyl)methyl]-N,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 43383719 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-N,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)N(C)Cc1cccc(N)c1 |
| InChI | InChI=1S/C13H15N3O2/c1-9-12(7-15-18-9)13(17)16(2)8-10-4-3-5-11(14)6-10/h3-7H,8,14H2,1-2H3 |
| InChIKey | YEFKRQXEVJTREY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|