About (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine
(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine (PubChem CID 43384519) has the molecular formula C15H17NOS
and a molecular weight of 259.37 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine.
Molecular Properties
| Compound Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine |
| PubChem CID | 43384519 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine |
| SMILES | Cc1ccc(C(N)c2ccc3c(c2)CC(C)O3)s1 |
| InChI | InChI=1S/C15H17NOS/c1-9-7-12-8-11(4-5-13(12)17-9)15(16)14-6-3-10(2)18-14/h3-6,8-9,15H,7,16H2,1-2H3 |
| InChIKey | CLULPWKZFZUPOX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine?
The IUPAC name of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine (CID 43384519) is (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine.
What is the SMILES notation for (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine?
The canonical SMILES for (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine is Cc1ccc(C(N)c2ccc3c(c2)CC(C)O3)s1.
What is the InChIKey of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine?
The InChIKey is CLULPWKZFZUPOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NOS/c1-9-7-12-8-11(4-5-13(12)17-9)15(16)14-6-3-10(2)18-14/h3-6,8-9,15H,7,16H2,1-2H3.
What are the key properties of (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine?
(2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine has a molecular weight of 259.37 g/mol, XLogP of 3.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,3-dihydro-1-benzofuran-5-yl)-(5-methylthiophen-2-yl)methanamine is sourced from PubChem (CID 43384519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).