About 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol
2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol (PubChem CID 43384938) has the molecular formula C10H12N2OS2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol.
Molecular Properties
| Compound Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol |
| PubChem CID | 43384938 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol |
| SMILES | Cc1sc2ncnc(SCCO)c2c1C |
| InChI | InChI=1S/C10H12N2OS2/c1-6-7(2)15-10-8(6)9(11-5-12-10)14-4-3-13/h5,13H,3-4H2,1-2H3 |
| InChIKey | CLPOGZDHIZSFPY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol?
The IUPAC name of 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol (CID 43384938) is 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol.
What is the SMILES notation for 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol?
The canonical SMILES for 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol is Cc1sc2ncnc(SCCO)c2c1C.
What is the InChIKey of 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol?
The InChIKey is CLPOGZDHIZSFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS2/c1-6-7(2)15-10-8(6)9(11-5-12-10)14-4-3-13/h5,13H,3-4H2,1-2H3.
What are the key properties of 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol?
2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol has a molecular weight of 240.35 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)sulfanylethanol is sourced from PubChem (CID 43384938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).