C15H18N2O2S2 — CID 43388703
2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxycyclohexyl)acetamide (PubChem CID 43388703) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxycyclohexyl)acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 43388703 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-(4-hydroxycyclohexyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2s1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C15H18N2O2S2/c18-11-7-5-10(6-8-11)16-14(19)9-20-15-17-12-3-1-2-4-13(12)21-15/h1-4,10-11,18H,5-9H2,(H,16,19) |
| InChIKey | VHIWIUDKZOQUFF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |