About propyl 2-bromobenzoate
propyl 2-bromobenzoate (PubChem CID 43389521) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is propyl 2-bromobenzoate.
Molecular Properties
| Compound Name | propyl 2-bromobenzoate |
| PubChem CID | 43389521 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | propyl 2-bromobenzoate |
| SMILES | CCCOC(=O)c1ccccc1Br |
| InChI | InChI=1S/C10H11BrO2/c1-2-7-13-10(12)8-5-3-4-6-9(8)11/h3-6H,2,7H2,1H3 |
| InChIKey | NCFQAUCIZMHITH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propyl 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2-bromobenzoate?
The IUPAC name of propyl 2-bromobenzoate (CID 43389521) is propyl 2-bromobenzoate.
What is the SMILES notation for propyl 2-bromobenzoate?
The canonical SMILES for propyl 2-bromobenzoate is CCCOC(=O)c1ccccc1Br.
What is the InChIKey of propyl 2-bromobenzoate?
The InChIKey is NCFQAUCIZMHITH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-2-7-13-10(12)8-5-3-4-6-9(8)11/h3-6H,2,7H2,1H3.
What are the key properties of propyl 2-bromobenzoate?
propyl 2-bromobenzoate has a molecular weight of 243.10 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2-bromobenzoate is sourced from PubChem (CID 43389521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).