About N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide
N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide (PubChem CID 43389900) has the molecular formula C9H15N3O2S
and a molecular weight of 229.30 g/mol. Its IUPAC name is N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide.
Molecular Properties
| Compound Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide |
| PubChem CID | 43389900 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide |
| SMILES | Cc1n[nH]c(C)c1NC(=O)CSCCO |
| InChI | InChI=1S/C9H15N3O2S/c1-6-9(7(2)12-11-6)10-8(14)5-15-4-3-13/h13H,3-5H2,1-2H3,(H,10,14)(H,11,12) |
| InChIKey | XVRHPYDVBLXTJG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide?
The IUPAC name of N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide (CID 43389900) is N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide.
What is the SMILES notation for N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide?
The canonical SMILES for N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide is Cc1n[nH]c(C)c1NC(=O)CSCCO.
What is the InChIKey of N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide?
The InChIKey is XVRHPYDVBLXTJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-6-9(7(2)12-11-6)10-8(14)5-15-4-3-13/h13H,3-5H2,1-2H3,(H,10,14)(H,11,12).
What are the key properties of N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide?
N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide has a molecular weight of 229.30 g/mol, XLogP of 0.69, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethyl-1H-pyrazol-4-yl)-2-(2-hydroxyethylsulfanyl)acetamide is sourced from PubChem (CID 43389900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).