C13H19NO3 — CID 43391085
2-(3,5-dimethylphenoxy)-N-(2-hydroxypropyl)acetamide (PubChem CID 43391085) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-N-(2-hydroxypropyl)acetamide.
| Compound Name | 2-(3,5-dimethylphenoxy)-N-(2-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 43391085 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-N-(2-hydroxypropyl)acetamide |
| SMILES | Cc1cc(C)cc(OCC(=O)NCC(C)O)c1 |
| InChI | InChI=1S/C13H19NO3/c1-9-4-10(2)6-12(5-9)17-8-13(16)14-7-11(3)15/h4-6,11,15H,7-8H2,1-3H3,(H,14,16) |
| InChIKey | JPFYWLBUEHOQTA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |