C11H16N2O4 — CID 43393003
3-[(2-methoxy-5-nitrophenyl)methylamino]propan-1-ol (PubChem CID 43393003) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 3-[(2-methoxy-5-nitrophenyl)methylamino]propan-1-ol.
| Compound Name | 3-[(2-methoxy-5-nitrophenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 43393003 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 3-[(2-methoxy-5-nitrophenyl)methylamino]propan-1-ol |
| SMILES | COc1ccc([N+](=O)[O-])cc1CNCCCO |
| InChI | InChI=1S/C11H16N2O4/c1-17-11-4-3-10(13(15)16)7-9(11)8-12-5-2-6-14/h3-4,7,12,14H,2,5-6,8H2,1H3 |
| InChIKey | HEDPTZUTKJLFRG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|