C9H13N3O2S — CID 43393276
(3-hydroxypiperidin-1-yl)-(4-methylthiadiazol-5-yl)methanone (PubChem CID 43393276) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is (3-hydroxypiperidin-1-yl)-(4-methylthiadiazol-5-yl)methanone.
| Compound Name | (3-hydroxypiperidin-1-yl)-(4-methylthiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 43393276 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (3-hydroxypiperidin-1-yl)-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C9H13N3O2S/c1-6-8(15-11-10-6)9(14)12-4-2-3-7(13)5-12/h7,13H,2-5H2,1H3 |
| InChIKey | TUTYZULKHBNENJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |