About N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline (PubChem CID 43393526) has the molecular formula C16H16BrNO2
and a molecular weight of 334.21 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline.
Molecular Properties
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline |
| PubChem CID | 43393526 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(NCc2cc3c(cc2Br)OCO3)c1 |
| InChI | InChI=1S/C16H16BrNO2/c1-10-3-11(2)5-13(4-10)18-8-12-6-15-16(7-14(12)17)20-9-19-15/h3-7,18H,8-9H2,1-2H3 |
| InChIKey | LWRGOUWQMQIBAR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline?
The IUPAC name of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline (CID 43393526) is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline.
What is the SMILES notation for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline?
The canonical SMILES for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline is Cc1cc(C)cc(NCc2cc3c(cc2Br)OCO3)c1.
What is the InChIKey of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline?
The InChIKey is LWRGOUWQMQIBAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNO2/c1-10-3-11(2)5-13(4-10)18-8-12-6-15-16(7-14(12)17)20-9-19-15/h3-7,18H,8-9H2,1-2H3.
What are the key properties of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline?
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline has a molecular weight of 334.21 g/mol, XLogP of 4.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-3,5-dimethylaniline is sourced from PubChem (CID 43393526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).