C11H24N2S — CID 43394800
N',N'-diethyl-N-(thian-4-yl)ethane-1,2-diamine (PubChem CID 43394800) has the molecular formula C11H24N2S and a molecular weight of 216.39 g/mol. Its IUPAC name is N',N'-diethyl-N-(thian-4-yl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-(thian-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 43394800 |
| Molecular Formula | C11H24N2S |
| Molecular Weight | 216.39 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | N',N'-diethyl-N-(thian-4-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNC1CCSCC1 |
| InChI | InChI=1S/C11H24N2S/c1-3-13(4-2)8-7-12-11-5-9-14-10-6-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | WZXFQVIWSIFZOO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |