C13H11F2NO2 — CID 43394983
1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,5-dimethylpyrrole (PubChem CID 43394983) has the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,5-dimethylpyrrole.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 43394983 |
| Molecular Formula | C13H11F2NO2 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C13H11F2NO2/c1-8-3-4-9(2)16(8)10-5-6-11-12(7-10)18-13(14,15)17-11/h3-7H,1-2H3 |
| InChIKey | LPVUQRLMQHRQFA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|