C13H17N3 — CID 43395112
N-butyl-4-methylphthalazin-1-amine (PubChem CID 43395112) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-butyl-4-methylphthalazin-1-amine.
| Compound Name | N-butyl-4-methylphthalazin-1-amine |
|---|---|
| PubChem CID | 43395112 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-butyl-4-methylphthalazin-1-amine |
| SMILES | CCCCNc1nnc(C)c2ccccc12 |
| InChI | InChI=1S/C13H17N3/c1-3-4-9-14-13-12-8-6-5-7-11(12)10(2)15-16-13/h5-8H,3-4,9H2,1-2H3,(H,14,16) |
| InChIKey | IRSWEIMPDUMMMV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|