About 3-methylbutanoyl isothiocyanate
3-methylbutanoyl isothiocyanate (PubChem CID 43395585) has the molecular formula C6H9NOS
and a molecular weight of 143.21 g/mol. Its IUPAC name is 3-methylbutanoyl isothiocyanate.
Molecular Properties
| Compound Name | 3-methylbutanoyl isothiocyanate |
| PubChem CID | 43395585 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 3-methylbutanoyl isothiocyanate |
| SMILES | CC(C)CC(=O)N=C=S |
| InChI | InChI=1S/C6H9NOS/c1-5(2)3-6(8)7-4-9/h5H,3H2,1-2H3 |
| InChIKey | LAJGSTFFYMRWDX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutanoyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanoyl isothiocyanate?
The IUPAC name of 3-methylbutanoyl isothiocyanate (CID 43395585) is 3-methylbutanoyl isothiocyanate.
What is the SMILES notation for 3-methylbutanoyl isothiocyanate?
The canonical SMILES for 3-methylbutanoyl isothiocyanate is CC(C)CC(=O)N=C=S.
What is the InChIKey of 3-methylbutanoyl isothiocyanate?
The InChIKey is LAJGSTFFYMRWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NOS/c1-5(2)3-6(8)7-4-9/h5H,3H2,1-2H3.
What are the key properties of 3-methylbutanoyl isothiocyanate?
3-methylbutanoyl isothiocyanate has a molecular weight of 143.21 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanoyl isothiocyanate is sourced from PubChem (CID 43395585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).