C13H21NO3 — CID 43396390
6-(3-methylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 43396390) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 6-(3-methylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(3-methylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 43396390 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 6-(3-methylbutylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)CCNC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C13H21NO3/c1-9(2)7-8-14-12(15)10-5-3-4-6-11(10)13(16)17/h3-4,9-11H,5-8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | OFEMBWAJHNPNPJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|