About 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid
6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 43396578) has the molecular formula C12H17NO5S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| PubChem CID | 43396578 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17NO5S/c14-11(13-8-5-6-19(17,18)7-8)9-3-1-2-4-10(9)12(15)16/h1-2,8-10H,3-7H2,(H,13,14)(H,15,16) |
| InChIKey | SISPNTRQQLNRHH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (CID 43396578) is 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid is O=C(O)C1CC=CCC1C(=O)NC1CCS(=O)(=O)C1.
What is the InChIKey of 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
The InChIKey is SISPNTRQQLNRHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5S/c14-11(13-8-5-6-19(17,18)7-8)9-3-1-2-4-10(9)12(15)16/h1-2,8-10H,3-7H2,(H,13,14)(H,15,16).
What are the key properties of 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid has a molecular weight of 287.34 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1,1-dioxothiolan-3-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 43396578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).