C12H10Cl2N2OS — CID 43396646
5,6-dichloro-N-methyl-N-(thiophen-3-ylmethyl)pyridine-3-carboxamide (PubChem CID 43396646) has the molecular formula C12H10Cl2N2OS and a molecular weight of 301.20 g/mol. Its IUPAC name is 5,6-dichloro-N-methyl-N-(thiophen-3-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-methyl-N-(thiophen-3-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43396646 |
| Molecular Formula | C12H10Cl2N2OS |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 5,6-dichloro-N-methyl-N-(thiophen-3-ylmethyl)pyridine-3-carboxamide |
| SMILES | CN(Cc1ccsc1)C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2OS/c1-16(6-8-2-3-18-7-8)12(17)9-4-10(13)11(14)15-5-9/h2-5,7H,6H2,1H3 |
| InChIKey | DLODLJABVFLNPC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|