About N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide
N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 43397845) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
| PubChem CID | 43397845 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C9H15N3O2/c1-3-12(4-2)9(14)7-5-6-8(13)11-10-7/h3-6H2,1-2H3,(H,11,13) |
| InChIKey | JQZCUEKOVNZXAQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
The IUPAC name of N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide (CID 43397845) is N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide.
What is the SMILES notation for N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
The canonical SMILES for N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide is CCN(CC)C(=O)C1=NNC(=O)CC1.
What is the InChIKey of N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
The InChIKey is JQZCUEKOVNZXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-3-12(4-2)9(14)7-5-6-8(13)11-10-7/h3-6H2,1-2H3,(H,11,13).
What are the key properties of N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide?
N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide has a molecular weight of 197.24 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-6-oxo-4,5-dihydro-1H-pyridazine-3-carboxamide is sourced from PubChem (CID 43397845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).