About 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide
6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 43397852) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide |
| PubChem CID | 43397852 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C11H19N3O2/c1-3-7-14(8-4-2)11(16)9-5-6-10(15)13-12-9/h3-8H2,1-2H3,(H,13,15) |
| InChIKey | RHDLSEVUZMRBRO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
The IUPAC name of 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide (CID 43397852) is 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide.
What is the SMILES notation for 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
The canonical SMILES for 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide is CCCN(CCC)C(=O)C1=NNC(=O)CC1.
What is the InChIKey of 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
The InChIKey is RHDLSEVUZMRBRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-3-7-14(8-4-2)11(16)9-5-6-10(15)13-12-9/h3-8H2,1-2H3,(H,13,15).
What are the key properties of 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide has a molecular weight of 225.29 g/mol, XLogP of 0.90, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N,N-dipropyl-4,5-dihydro-1H-pyridazine-3-carboxamide is sourced from PubChem (CID 43397852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).