About 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide
6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 43397890) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide |
| PubChem CID | 43397890 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | C=CCNC(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C8H11N3O2/c1-2-5-9-8(13)6-3-4-7(12)11-10-6/h2H,1,3-5H2,(H,9,13)(H,11,12) |
| InChIKey | KHLBOAXSCBSHJD-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
The IUPAC name of 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide (CID 43397890) is 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide.
What is the SMILES notation for 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
The canonical SMILES for 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide is C=CCNC(=O)C1=NNC(=O)CC1.
What is the InChIKey of 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
The InChIKey is KHLBOAXSCBSHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-2-5-9-8(13)6-3-4-7(12)11-10-6/h2H,1,3-5H2,(H,9,13)(H,11,12).
What are the key properties of 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide?
6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide has a molecular weight of 181.19 g/mol, XLogP of -0.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-N-prop-2-enyl-4,5-dihydro-1H-pyridazine-3-carboxamide is sourced from PubChem (CID 43397890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).