C11H13BrN2O5S — CID 43398569
2-bromo-5-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]benzoic acid (PubChem CID 43398569) has the molecular formula C11H13BrN2O5S and a molecular weight of 365.21 g/mol. Its IUPAC name is 2-bromo-5-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]benzoic acid.
| Compound Name | 2-bromo-5-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 43398569 |
| Molecular Formula | C11H13BrN2O5S |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 2-bromo-5-[[2-(ethylamino)-2-oxoethyl]sulfamoyl]benzoic acid |
| SMILES | CCNC(=O)CNS(=O)(=O)c1ccc(Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H13BrN2O5S/c1-2-13-10(15)6-14-20(18,19)7-3-4-9(12)8(5-7)11(16)17/h3-5,14H,2,6H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | LRCVFGDZZVKXNB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |