C13H13FN2 — CID 43400460
N-[2-(3-fluorophenyl)ethyl]pyridin-2-amine (PubChem CID 43400460) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]pyridin-2-amine.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 43400460 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]pyridin-2-amine |
| SMILES | Fc1cccc(CCNc2ccccn2)c1 |
| InChI | InChI=1S/C13H13FN2/c14-12-5-3-4-11(10-12)7-9-16-13-6-1-2-8-15-13/h1-6,8,10H,7,9H2,(H,15,16) |
| InChIKey | AHURJWOGPCDNGM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |