C13H19FN2O — CID 43400999
2-[1-(2-fluorophenyl)ethylamino]-N-propylacetamide (PubChem CID 43400999) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)ethylamino]-N-propylacetamide.
| Compound Name | 2-[1-(2-fluorophenyl)ethylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 43400999 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-[1-(2-fluorophenyl)ethylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNC(C)c1ccccc1F |
| InChI | InChI=1S/C13H19FN2O/c1-3-8-15-13(17)9-16-10(2)11-6-4-5-7-12(11)14/h4-7,10,16H,3,8-9H2,1-2H3,(H,15,17) |
| InChIKey | ZROCRHYXMNLTDC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |