C12H17FN2O — CID 43401960
N-ethyl-2-[2-(3-fluorophenyl)ethylamino]acetamide (PubChem CID 43401960) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is N-ethyl-2-[2-(3-fluorophenyl)ethylamino]acetamide.
| Compound Name | N-ethyl-2-[2-(3-fluorophenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 43401960 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-ethyl-2-[2-(3-fluorophenyl)ethylamino]acetamide |
| SMILES | CCNC(=O)CNCCc1cccc(F)c1 |
| InChI | InChI=1S/C12H17FN2O/c1-2-15-12(16)9-14-7-6-10-4-3-5-11(13)8-10/h3-5,8,14H,2,6-7,9H2,1H3,(H,15,16) |
| InChIKey | VZPZCUSEPDKKTM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|