C12H19NO2 — CID 43403758
1-(furan-2-yl)-N-(oxan-2-ylmethyl)ethanamine (PubChem CID 43403758) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-(oxan-2-ylmethyl)ethanamine.
| Compound Name | 1-(furan-2-yl)-N-(oxan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43403758 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 1-(furan-2-yl)-N-(oxan-2-ylmethyl)ethanamine |
| SMILES | CC(NCC1CCCCO1)c1ccco1 |
| InChI | InChI=1S/C12H19NO2/c1-10(12-6-4-8-15-12)13-9-11-5-2-3-7-14-11/h4,6,8,10-11,13H,2-3,5,7,9H2,1H3 |
| InChIKey | POSNSJCPAUVTIX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |