About methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate
methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate (PubChem CID 43404738) has the molecular formula C8H11N3O4
and a molecular weight of 213.19 g/mol. Its IUPAC name is methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate |
| PubChem CID | 43404738 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)C1=NNC(=O)CC1 |
| InChI | InChI=1S/C8H11N3O4/c1-15-7(13)4-9-8(14)5-2-3-6(12)11-10-5/h2-4H2,1H3,(H,9,14)(H,11,12) |
| InChIKey | KGSPEBAGXCQCEX-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate?
The IUPAC name of methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate (CID 43404738) is methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate.
What is the SMILES notation for methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate?
The canonical SMILES for methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate is COC(=O)CNC(=O)C1=NNC(=O)CC1.
What is the InChIKey of methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate?
The InChIKey is KGSPEBAGXCQCEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4/c1-15-7(13)4-9-8(14)5-2-3-6(12)11-10-5/h2-4H2,1H3,(H,9,14)(H,11,12).
What are the key properties of methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate?
methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate has a molecular weight of 213.19 g/mol, XLogP of -1.46, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(6-oxo-4,5-dihydro-1H-pyridazine-3-carbonyl)amino]acetate is sourced from PubChem (CID 43404738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).