About methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate
methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate (PubChem CID 43404840) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate |
| PubChem CID | 43404840 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate |
| SMILES | C/C=C/C=C/C(=O)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C13H19NO3/c1-3-4-5-6-12(15)14-9-7-11(8-10-14)13(16)17-2/h3-6,11H,7-10H2,1-2H3/b4-3+,6-5+ |
| InChIKey | RGXAFLDVNASICL-VNKDHWASSA-N |
| XLogP | 1.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate?
The IUPAC name of methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate (CID 43404840) is methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate?
The canonical SMILES for methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate is C/C=C/C=C/C(=O)N1CCC(C(=O)OC)CC1.
What is the InChIKey of methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate?
The InChIKey is RGXAFLDVNASICL-VNKDHWASSA-N. The full InChI is InChI=1S/C13H19NO3/c1-3-4-5-6-12(15)14-9-7-11(8-10-14)13(16)17-2/h3-6,11H,7-10H2,1-2H3/b4-3+,6-5+.
What are the key properties of methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate?
methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate has a molecular weight of 237.30 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2E,4E)-hexa-2,4-dienoyl]piperidine-4-carboxylate is sourced from PubChem (CID 43404840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).