About methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate
methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate (PubChem CID 43407099) has the molecular formula C8H11N3O5
and a molecular weight of 229.19 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate |
| PubChem CID | 43407099 |
| Molecular Formula | C8H11N3O5 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(CO)NC(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O5/c1-16-7(14)5(3-12)10-6(13)4-2-9-8(15)11-4/h2,5,12H,3H2,1H3,(H,10,13)(H2,9,11,15) |
| InChIKey | PFUMMPWGEJGLQR-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate?
The IUPAC name of methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate (CID 43407099) is methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate.
What is the SMILES notation for methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate?
The canonical SMILES for methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate is COC(=O)C(CO)NC(=O)c1c[nH]c(=O)[nH]1.
What is the InChIKey of methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate?
The InChIKey is PFUMMPWGEJGLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O5/c1-16-7(14)5(3-12)10-6(13)4-2-9-8(15)11-4/h2,5,12H,3H2,1H3,(H,10,13)(H2,9,11,15).
What are the key properties of methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate?
methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate has a molecular weight of 229.19 g/mol, XLogP of -2.03, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-2-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]propanoate is sourced from PubChem (CID 43407099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).