methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate

C12H13Cl2NO3 — CID 43407394

IUPACmethyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate
SMILESCOC(=O)CN(C)C(=O)Cc1c(Cl)cccc1Cl
InChIInChI=1S/C12H13Cl2NO3/c1-15(7-12(17)18-2)11(16)6-8-9(13)4-3-5-10(8)14/h3-5H,6-7H2,1-2H3
InChIKeyLGBOFWZQOIRSJS-UHFFFAOYSA-N
MW290.15 g/mol
LogP2.17
Rot. Bonds4

About methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate

methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate (PubChem CID 43407394) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate
PubChem CID43407394
Molecular FormulaC12H13Cl2NO3
Molecular Weight290.15 g/mol
Exact Mass289.03
IUPAC Namemethyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate
SMILESCOC(=O)CN(C)C(=O)Cc1c(Cl)cccc1Cl
InChIInChI=1S/C12H13Cl2NO3/c1-15(7-12(17)18-2)11(16)6-8-9(13)4-3-5-10(8)14/h3-5H,6-7H2,1-2H3
InChIKeyLGBOFWZQOIRSJS-UHFFFAOYSA-N
XLogP2.17
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.15
LogP ≤ 52.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate?
The IUPAC name of methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate (CID 43407394) is methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate.
What is the SMILES notation for methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate?
The canonical SMILES for methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate is COC(=O)CN(C)C(=O)Cc1c(Cl)cccc1Cl.
What is the InChIKey of methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate?
The InChIKey is LGBOFWZQOIRSJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO3/c1-15(7-12(17)18-2)11(16)6-8-9(13)4-3-5-10(8)14/h3-5H,6-7H2,1-2H3.
What are the key properties of methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate?
methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate has a molecular weight of 290.15 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(2,6-dichlorophenyl)acetyl]-methylamino]acetate is sourced from PubChem (CID 43407394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).