About methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate
methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate (PubChem CID 43408766) has the molecular formula C12H17N3O5
and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate |
| PubChem CID | 43408766 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)Cc1c(C)nc(=O)[nH]c1C |
| InChI | InChI=1S/C12H17N3O5/c1-6-8(7(2)14-12(19)13-6)4-10(17)15-9(5-16)11(18)20-3/h9,16H,4-5H2,1-3H3,(H,15,17)(H,13,14,19) |
| InChIKey | FFXVEAOLSUIMDF-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate?
The IUPAC name of methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate (CID 43408766) is methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate.
What is the SMILES notation for methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate?
The canonical SMILES for methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate is COC(=O)C(CO)NC(=O)Cc1c(C)nc(=O)[nH]c1C.
What is the InChIKey of methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate?
The InChIKey is FFXVEAOLSUIMDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O5/c1-6-8(7(2)14-12(19)13-6)4-10(17)15-9(5-16)11(18)20-3/h9,16H,4-5H2,1-3H3,(H,15,17)(H,13,14,19).
What are the key properties of methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate?
methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate has a molecular weight of 283.28 g/mol, XLogP of -1.42, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)acetyl]amino]-3-hydroxypropanoate is sourced from PubChem (CID 43408766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).