C11H14N2O4 — CID 43409093
methyl 2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]acetate (PubChem CID 43409093) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is methyl 2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 43409093 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | methyl 2-[(4-acetyl-1-methylpyrrole-2-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc(C(C)=O)cn1C |
| InChI | InChI=1S/C11H14N2O4/c1-7(14)8-4-9(13(2)6-8)11(16)12-5-10(15)17-3/h4,6H,5H2,1-3H3,(H,12,16) |
| InChIKey | PWCKXQZIPVCVCM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |