About methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate
methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate (PubChem CID 43409422) has the molecular formula C11H15N3O5
and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate |
| PubChem CID | 43409422 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate |
| SMILES | COC(=O)CNC(=O)CCc1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O5/c1-6-7(10(17)14-11(18)13-6)3-4-8(15)12-5-9(16)19-2/h3-5H2,1-2H3,(H,12,15)(H2,13,14,17,18) |
| InChIKey | YHAAEBJNMQOPMR-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate?
The IUPAC name of methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate (CID 43409422) is methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate.
What is the SMILES notation for methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate?
The canonical SMILES for methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate is COC(=O)CNC(=O)CCc1c(C)[nH]c(=O)[nH]c1=O.
What is the InChIKey of methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate?
The InChIKey is YHAAEBJNMQOPMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O5/c1-6-7(10(17)14-11(18)13-6)3-4-8(15)12-5-9(16)19-2/h3-5H2,1-2H3,(H,12,15)(H2,13,14,17,18).
What are the key properties of methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate?
methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate has a molecular weight of 269.26 g/mol, XLogP of -1.41, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)propanoylamino]acetate is sourced from PubChem (CID 43409422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).