About methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate
methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate (PubChem CID 43409720) has the molecular formula C11H16N4O3S
and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate |
| PubChem CID | 43409720 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)CSc1nncn1C1CC1 |
| InChI | InChI=1S/C11H16N4O3S/c1-14(5-10(17)18-2)9(16)6-19-11-13-12-7-15(11)8-3-4-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | BUMLCVYKVFUMFI-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate?
The IUPAC name of methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate (CID 43409720) is methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate.
What is the SMILES notation for methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate?
The canonical SMILES for methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate is COC(=O)CN(C)C(=O)CSc1nncn1C1CC1.
What is the InChIKey of methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate?
The InChIKey is BUMLCVYKVFUMFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3S/c1-14(5-10(17)18-2)9(16)6-19-11-13-12-7-15(11)8-3-4-8/h7-8H,3-6H2,1-2H3.
What are the key properties of methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate?
methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate has a molecular weight of 284.34 g/mol, XLogP of 0.34, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[2-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-methylamino]acetate is sourced from PubChem (CID 43409720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).