2-[cycloheptyl(methyl)amino]acetic acid

C10H19NO2 — CID 43409736

IUPAC2-[cycloheptyl(methyl)amino]acetic acid
SMILESCN(CC(=O)O)C1CCCCCC1
InChIInChI=1S/C10H19NO2/c1-11(8-10(12)13)9-6-4-2-3-5-7-9/h9H,2-8H2,1H3,(H,12,13)
InChIKeyVJZZUZAAEGOZGS-UHFFFAOYSA-N
MW185.27 g/mol
LogP1.73
Rot. Bonds3

About 2-[cycloheptyl(methyl)amino]acetic acid

2-[cycloheptyl(methyl)amino]acetic acid (PubChem CID 43409736) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[cycloheptyl(methyl)amino]acetic acid.

Molecular Properties

Compound Name2-[cycloheptyl(methyl)amino]acetic acid
PubChem CID43409736
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Name2-[cycloheptyl(methyl)amino]acetic acid
SMILESCN(CC(=O)O)C1CCCCCC1
InChIInChI=1S/C10H19NO2/c1-11(8-10(12)13)9-6-4-2-3-5-7-9/h9H,2-8H2,1H3,(H,12,13)
InChIKeyVJZZUZAAEGOZGS-UHFFFAOYSA-N
XLogP1.73
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[cycloheptyl(methyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[cyclohexyl(deuteriomethyl)amino]acetic acid
CID 176582981
2-[azepan-4-yl(methyl)amino]acetic acid
CID 107173147
2-[methyl-(4-methylcyclohexyl)amino]acetic acid
CID 60712035
3-[cyclododecyl(methyl)amino]propanoic acid
CID 65063573
2-[(1-ethylazepan-4-yl)-methylamino]acetic acid
CID 65077241
2-[cyclohexyl(methyl)amino]acetamide
CID 22200523
2-[[2-[cyclohexyl(methyl)amino]acetyl]amino]acetic acid
CID 39258593
2-[cyclohexyl(ethylsulfonyl)amino]acetic acid
CID 50849243
2-[methyl(oxetan-3-yl)amino]acetic acid
CID 82417781
2-[(2-hydroxycyclopentyl)-methylamino]acetic acid
CID 60885872
2-[cycloheptyl(methyl)amino]acetohydrazide
CID 63574269
1-[cyclopentyl(methyl)amino]-3-methylbutan-2-one
CID 79395457

Frequently Asked Questions

What is the IUPAC name of 2-[cycloheptyl(methyl)amino]acetic acid?
The IUPAC name of 2-[cycloheptyl(methyl)amino]acetic acid (CID 43409736) is 2-[cycloheptyl(methyl)amino]acetic acid.
What is the SMILES notation for 2-[cycloheptyl(methyl)amino]acetic acid?
The canonical SMILES for 2-[cycloheptyl(methyl)amino]acetic acid is CN(CC(=O)O)C1CCCCCC1.
What is the InChIKey of 2-[cycloheptyl(methyl)amino]acetic acid?
The InChIKey is VJZZUZAAEGOZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-11(8-10(12)13)9-6-4-2-3-5-7-9/h9H,2-8H2,1H3,(H,12,13).
What are the key properties of 2-[cycloheptyl(methyl)amino]acetic acid?
2-[cycloheptyl(methyl)amino]acetic acid has a molecular weight of 185.27 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cycloheptyl(methyl)amino]acetic acid is sourced from PubChem (CID 43409736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).