About methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate
methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate (PubChem CID 43410295) has the molecular formula C12H15N3O5
and a molecular weight of 281.27 g/mol. Its IUPAC name is methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate |
| PubChem CID | 43410295 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H15N3O5/c1-20-11(18)8-3-2-4-15(8)10(17)6-7-5-9(16)14-12(19)13-7/h5,8H,2-4,6H2,1H3,(H2,13,14,16,19) |
| InChIKey | SUTYUQCHKMMJGK-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate?
The IUPAC name of methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate (CID 43410295) is methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate is COC(=O)C1CCCN1C(=O)Cc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate?
The InChIKey is SUTYUQCHKMMJGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O5/c1-20-11(18)8-3-2-4-15(8)10(17)6-7-5-9(16)14-12(19)13-7/h5,8H,2-4,6H2,1H3,(H2,13,14,16,19).
What are the key properties of methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate?
methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate has a molecular weight of 281.27 g/mol, XLogP of -1.23, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 43410295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).