C10H16N4O2 — CID 43410478
6-(cyclopentylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 43410478) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 6-(cyclopentylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(cyclopentylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 43410478 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 6-(cyclopentylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1nc(NC2CCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H16N4O2/c1-13-9(15)8(12-14(2)10(13)16)11-7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | RUUNSVUKKCOMJF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |