About 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide
2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide (PubChem CID 43410634) has the molecular formula C7H15N3O3S
and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide |
| PubChem CID | 43410634 |
| Molecular Formula | C7H15N3O3S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide |
| SMILES | CN(C/C(N)=N/O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15N3O3S/c1-10(4-7(8)9-11)6-2-3-14(12,13)5-6/h6,11H,2-5H2,1H3,(H2,8,9) |
| InChIKey | UETDWJCHXLFYSX-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide (CID 43410634) is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide is CN(C/C(N)=N/O)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide?
The InChIKey is UETDWJCHXLFYSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O3S/c1-10(4-7(8)9-11)6-2-3-14(12,13)5-6/h6,11H,2-5H2,1H3,(H2,8,9).
What are the key properties of 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide?
2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide has a molecular weight of 221.28 g/mol, XLogP of -1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxyethanimidamide is sourced from PubChem (CID 43410634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).