C12H23N5O2 — CID 43410684
6-[5-(diethylamino)pentan-2-ylamino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 43410684) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 6-[5-(diethylamino)pentan-2-ylamino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[5-(diethylamino)pentan-2-ylamino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 43410684 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 6-[5-(diethylamino)pentan-2-ylamino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | CCN(CC)CCCC(C)Nc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H23N5O2/c1-4-17(5-2)8-6-7-9(3)13-10-11(18)14-12(19)16-15-10/h9H,4-8H2,1-3H3,(H,13,15)(H2,14,16,18,19) |
| InChIKey | JQPGBOZIGIUQGC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |