C5H8N4O2 — CID 43410700
6-(ethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 43410700) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is 6-(ethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(ethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 43410700 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 6-(ethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | CCNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H8N4O2/c1-2-6-3-4(10)7-5(11)9-8-3/h2H2,1H3,(H,6,8)(H2,7,9,10,11) |
| InChIKey | QSSJDEVSQYQSMD-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |