C18H20N2O — CID 43411225
2-(2,3-dihydro-1H-inden-1-ylamino)-N-(3-methylphenyl)acetamide (PubChem CID 43411225) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-ylamino)-N-(3-methylphenyl)acetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-ylamino)-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43411225 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-ylamino)-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CNC2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2O/c1-13-5-4-7-15(11-13)20-18(21)12-19-17-10-9-14-6-2-3-8-16(14)17/h2-8,11,17,19H,9-10,12H2,1H3,(H,20,21) |
| InChIKey | PVPYCMPYPCNPCS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |