C15H14O3 — CID 43411851
2-(2,3-dihydro-1H-inden-5-yloxy)-1-(furan-2-yl)ethanone (PubChem CID 43411851) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yloxy)-1-(furan-2-yl)ethanone.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yloxy)-1-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 43411851 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yloxy)-1-(furan-2-yl)ethanone |
| SMILES | O=C(COc1ccc2c(c1)CCC2)c1ccco1 |
| InChI | InChI=1S/C15H14O3/c16-14(15-5-2-8-17-15)10-18-13-7-6-11-3-1-4-12(11)9-13/h2,5-9H,1,3-4,10H2 |
| InChIKey | TTWQSIBMDZSECE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |