C17H17FO2 — CID 43413394
2-(3-fluorophenoxy)-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 43413394) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-(3-fluorophenoxy)-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 43413394 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-(3-fluorophenoxy)-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)COc2cccc(F)c2)c(C)c1 |
| InChI | InChI=1S/C17H17FO2/c1-11-7-12(2)17(13(3)8-11)16(19)10-20-15-6-4-5-14(18)9-15/h4-9H,10H2,1-3H3 |
| InChIKey | YDTMOHGEDAZXSL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |