C18H21NO2 — CID 43416361
N-(2-hydroxy-2-phenylethyl)-2,4,6-trimethylbenzamide (PubChem CID 43416361) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-2,4,6-trimethylbenzamide.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 43416361 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NCC(O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H21NO2/c1-12-9-13(2)17(14(3)10-12)18(21)19-11-16(20)15-7-5-4-6-8-15/h4-10,16,20H,11H2,1-3H3,(H,19,21) |
| InChIKey | ZIMFELULKAUVIP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |