About (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one
(2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one (PubChem CID 43416823) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one |
| PubChem CID | 43416823 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C11H17NO2/c1-2-3-4-7-11(14)12-8-5-6-10(13)9-12/h2-4,7,10,13H,5-6,8-9H2,1H3/b3-2+,7-4+ |
| InChIKey | BQGOWCHOENRISV-AOGGBPEJSA-N |
| XLogP | 1.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one?
The IUPAC name of (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one (CID 43416823) is (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one.
What is the SMILES notation for (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one?
The canonical SMILES for (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one is C/C=C/C=C/C(=O)N1CCCC(O)C1.
What is the InChIKey of (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one?
The InChIKey is BQGOWCHOENRISV-AOGGBPEJSA-N. The full InChI is InChI=1S/C11H17NO2/c1-2-3-4-7-11(14)12-8-5-6-10(13)9-12/h2-4,7,10,13H,5-6,8-9H2,1H3/b3-2+,7-4+.
What are the key properties of (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one?
(2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one has a molecular weight of 195.26 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-1-(3-hydroxypiperidin-1-yl)hexa-2,4-dien-1-one is sourced from PubChem (CID 43416823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).