C11H16N2O3 — CID 43417318
1-(1-hydroxypropan-2-yl)-3-(2-methoxyphenyl)urea (PubChem CID 43417318) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(1-hydroxypropan-2-yl)-3-(2-methoxyphenyl)urea.
| Compound Name | 1-(1-hydroxypropan-2-yl)-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 43417318 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-(1-hydroxypropan-2-yl)-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NC(C)CO |
| InChI | InChI=1S/C11H16N2O3/c1-8(7-14)12-11(15)13-9-5-3-4-6-10(9)16-2/h3-6,8,14H,7H2,1-2H3,(H2,12,13,15) |
| InChIKey | MFEBVAADEYBQFY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |